CAS 1335140-62-9 appears in our catalog under these names: 5-Methanesulfonyl-2,3-dimethylaniline, 95%, 5-Methanesulfonyl-2,3-dimethylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3-dimethyl-5-methylsulfonylaniline (CAS 1335140-62-9) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2,3-dimethyl-5-methylsulfonylaniline. InChIKey: BGMSMXXAMQMAPG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2,3-dimethyl-5-methylsulfonylaniline |
| InChIKey | BGMSMXXAMQMAPG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)N)S(=O)(=O)C |
Computed by PubChem (NCBI)