Products 1335145-56-6
CAS 1335145-56-6 is the registry number for A-424274. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]quinoline (CAS 1335145-56-6) is a chemical compound with the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. IUPAC name: 3-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]quinoline. InChIKey: PKTSUYRXYHYCBU-SMDDNHRTSA-N.
| Molecular formula | C14H15N3 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | 3-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]quinoline |
| InChIKey | PKTSUYRXYHYCBU-SMDDNHRTSA-N |
| SMILES | C1[C@H]2CN(C[C@H]2N1)C3=CC4=CC=CC=C4N=C3 |
Computed by PubChem (NCBI)