Products 1335203-40-1
CAS 1335203-40-1 appears in our catalog under these names: 2-Amino-5-iodo-4-methoxy-benzoic acid, 95%, 2-Amino-5-iodo-4-methoxybenzoic acid, 98%, 2–Amino–5–iodo–4–methoxybenzoic acid, 2-Amino-5-iodo-4-methoxybenzoic acid, 2-Amino-5-iodo-4-methoxy-benzoic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 2,5g.
2-amino-5-iodo-4-methoxybenzoic acid (CAS 1335203-40-1) is a chemical compound with the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. IUPAC name: 2-amino-5-iodo-4-methoxybenzoic acid. InChIKey: BONNGMLFIVTCKG-UHFFFAOYSA-N.
| Molecular formula | C8H8INO3 |
|---|---|
| Molecular weight | 293.06 g/mol |
| IUPAC name | 2-amino-5-iodo-4-methoxybenzoic acid |
| InChIKey | BONNGMLFIVTCKG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C(=O)O)I |
Computed by PubChem (NCBI)