CAS 335078-07-4 appears in our catalog under these names: 2-Ethoxy-5-iodonicotinic acid, 95%, 2-Ethoxy-5-iodonicotinic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 250mg.
2-ethoxy-5-iodopyridine-3-carboxylic acid (CAS 335078-07-4) is a chemical compound with the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. IUPAC name: 2-ethoxy-5-iodopyridine-3-carboxylic acid. InChIKey: DHVUWACWJRDVBQ-UHFFFAOYSA-N.
| Molecular formula | C8H8INO3 |
|---|---|
| Molecular weight | 293.06 g/mol |
| IUPAC name | 2-ethoxy-5-iodopyridine-3-carboxylic acid |
| InChIKey | DHVUWACWJRDVBQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=N1)I)C(=O)O |
Computed by PubChem (NCBI)