Products 1616831-34-5

CAS 1616831-34-5 is the registry number for 2-Amino-5-iodo-3-methoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

2-amino-5-iodo-3-methoxybenzoic acid (CAS 1616831-34-5) is a chemical compound with the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. IUPAC name: 2-amino-5-iodo-3-methoxybenzoic acid. InChIKey: NKKFDBPMEHGDSB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8INO3
Molecular weight293.06 g/mol
IUPAC name2-amino-5-iodo-3-methoxybenzoic acid
InChIKeyNKKFDBPMEHGDSB-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1N)C(=O)O)I

Computed by PubChem (NCBI)