CAS 155928-39-5 appears in our catalog under these names: 4-Amino-5-iodo-2-methoxybenzoic Acid, 4-Amino-5-iodo-2-methoxybenzenecarboxylic acid, 95%, 4-Amino-5-iodo-2-methoxybenzoic acid 95%, 4-Amino-5-iodo-2-methoxybenzenecarboxylic acid, 95%, 95%, 4-Amino-5-iodo-2-methoxybenzoic acid, 98%. Offered by: TRC, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 5g, 10g, 1g.
4-amino-5-iodo-2-methoxybenzoic acid (CAS 155928-39-5) is a chemical compound with the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. IUPAC name: 4-amino-5-iodo-2-methoxybenzoic acid. InChIKey: XEQJZCQCBUXZJK-UHFFFAOYSA-N.
| Molecular formula | C8H8INO3 |
|---|---|
| Molecular weight | 293.06 g/mol |
| IUPAC name | 4-amino-5-iodo-2-methoxybenzoic acid |
| InChIKey | XEQJZCQCBUXZJK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)I)N |
Computed by PubChem (NCBI)