CAS 1335220-62-6 is the registry number for 4-([Cis-2,6-dimethylmorpholin-4-yl]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]benzoic acid (CAS 1335220-62-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]benzoic acid. InChIKey: PDXOUFOUVXIPDL-PHIMTYICSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]benzoic acid |
| InChIKey | PDXOUFOUVXIPDL-PHIMTYICSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)