CAS 1335513-63-7 is the registry number for 5-Bromo-4-fluoro-2-iodobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-bromo-4-fluoro-2-iodobenzoic acid (CAS 1335513-63-7) is a chemical compound with the molecular formula C7H3BrFIO2 and a molecular weight of 344.90 g/mol. IUPAC name: 5-bromo-4-fluoro-2-iodobenzoic acid. InChIKey: JKNWCJQYQUBDFL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFIO2 |
|---|---|
| Molecular weight | 344.90 g/mol |
| IUPAC name | 5-bromo-4-fluoro-2-iodobenzoic acid |
| InChIKey | JKNWCJQYQUBDFL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)I)C(=O)O |
Computed by PubChem (NCBI)