Products 133562-28-4
CAS 133562-28-4 is the registry number for 2-Amino-1-(2,3-dichloro-phenyl)-ethanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-(2,3-dichlorophenyl)ethanol (CAS 133562-28-4) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-amino-1-(2,3-dichlorophenyl)ethanol. InChIKey: VLSXVFMMYPAJSR-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-amino-1-(2,3-dichlorophenyl)ethanol |
| InChIKey | VLSXVFMMYPAJSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(CN)O |
Computed by PubChem (NCBI)