CAS 133567-10-9 appears in our catalog under these names: cis-Methyl 3-methylpiperidine-4-carboxylate hydrochloride, 95%, Cis-methyl 3-methylpiperidine-4-carboxylate hydrochloride, 97%, rac-methyl (3R,4R)-3-methylpiperidine-4-carboxylate hydrochloride, cis, Cis-methyl 3-methylpiperidine-4-carboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 0,5g, 50mg, 500mg.
Methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride (CAS 133567-10-9) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: LIBNHIYBEVBSKI-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | LIBNHIYBEVBSKI-UOERWJHTSA-N |
| SMILES | C[C@H]1CNCC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)