Products 2375164-81-9
CAS 2375164-81-9 is the registry number for methyl (3S,4S)-3-methylpiperidine-4-carboxylate,hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
Methyl (3S,4S)-3-methylpiperidine-4-carboxylate;hydrochloride (CAS 2375164-81-9) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3S,4S)-3-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: LIBNHIYBEVBSKI-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3S,4S)-3-methylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | LIBNHIYBEVBSKI-HHQFNNIRSA-N |
| SMILES | C[C@@H]1CNCC[C@@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)