CAS 1400797-25-2 is the registry number for (3R,4R)-Methyl 3-methylpiperidine-4-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride (CAS 1400797-25-2) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: LIBNHIYBEVBSKI-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | LIBNHIYBEVBSKI-UOERWJHTSA-N |
| SMILES | C[C@H]1CNCC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)