Products 1400797-25-2

CAS 1400797-25-2 is the registry number for (3R,4R)-Methyl 3-methylpiperidine-4-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride (CAS 1400797-25-2) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: LIBNHIYBEVBSKI-UOERWJHTSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC namemethyl (3R,4R)-3-methylpiperidine-4-carboxylate;hydrochloride
InChIKeyLIBNHIYBEVBSKI-UOERWJHTSA-N
SMILESC[C@H]1CNCC[C@H]1C(=O)OC.Cl

Computed by PubChem (NCBI)