Products 133627-17-5
CAS 133627-17-5 appears in our catalog under these names: Nevirapine EP Impurity A, BIRH 414, 11-Ethyl-4-methyl-5,11-dihydro-6H-dipyrido (3,2-b:2',3'-e)(1,4)diazepin-6-one, 5，11–dihydro–6H–11–ethyl–4–Methyl–dipyrido(3，2–b：2'，3'–e)(1，4)diazepin–6–one, BIRH 414, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Chemat. Available pack sizes: on request, 250mg, 4x25mg, 25mg, 100mg, 10mg, 1mg, 5mg.
2-ethyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one (CAS 133627-17-5) is a chemical compound with the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. IUPAC name: 2-ethyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one. InChIKey: HDVZWQWXAQRFKJ-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | 2-ethyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one |
| InChIKey | HDVZWQWXAQRFKJ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC=N2)C(=O)NC3=C(C=CN=C31)C |
Computed by PubChem (NCBI)