CAS 934976-48-4 is the registry number for N2-Methyl-4’-OH-PhIP. Offered by: TRC. Available pack sizes: 100mg.
4-[1-methyl-2-(methylamino)imidazo[4,5-b]pyridin-6-yl]phenol (CAS 934976-48-4) is a chemical compound with the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. IUPAC name: 4-[1-methyl-2-(methylamino)imidazo[4,5-b]pyridin-6-yl]phenol. InChIKey: NADCHEREJJYXNY-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | 4-[1-methyl-2-(methylamino)imidazo[4,5-b]pyridin-6-yl]phenol |
| InChIKey | NADCHEREJJYXNY-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(N1C)C=C(C=N2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)