Products 7562-91-6
CAS 7562-91-6 is the registry number for 2-Amino-N-(4-(phenyldiazenyl)phenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-N-(4-phenyldiazenylphenyl)acetamide (CAS 7562-91-6) is a chemical compound with the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. IUPAC name: 2-amino-N-(4-phenyldiazenylphenyl)acetamide. InChIKey: NUOZYXSTSXKJNQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | 2-amino-N-(4-phenyldiazenylphenyl)acetamide |
| InChIKey | NUOZYXSTSXKJNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NC(=O)CN |
Computed by PubChem (NCBI)