CAS 1797911-00-2 is the registry number for 4'-Methoxy PhIP, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
6-(4-methoxyphenyl)-1-methylimidazo[4,5-b]pyridin-2-amine (CAS 1797911-00-2) is a chemical compound with the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. IUPAC name: 6-(4-methoxyphenyl)-1-methylimidazo[4,5-b]pyridin-2-amine. InChIKey: BGVKLIYCFPEOQN-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-1-methylimidazo[4,5-b]pyridin-2-amine |
| InChIKey | BGVKLIYCFPEOQN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=CC(=C2)C3=CC=C(C=C3)OC)N=C1N |
Computed by PubChem (NCBI)