Products 1336949-16-6

CAS 1336949-16-6 is the registry number for 4-Methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylic acid (CAS 1336949-16-6) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 4-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylic acid. InChIKey: OZHRYHQLLYWLQA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O3
Molecular weight204.22 g/mol
IUPAC name4-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylic acid
InChIKeyOZHRYHQLLYWLQA-UHFFFAOYSA-N
SMILESCC1=CC(=CC2=C1CCCC2=O)C(=O)O

Computed by PubChem (NCBI)