Products 133695-00-8
CAS 133695-00-8 is the registry number for trans-Hydroxydavanone - Artemisia sp.. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(E,2S)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one (CAS 133695-00-8) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (E,2S)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one. InChIKey: WQUKMIHCFQFPQG-MYLFNHQMSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (E,2S)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one |
| InChIKey | WQUKMIHCFQFPQG-MYLFNHQMSA-N |
| SMILES | C[C@@H]([C@@H]1CC[C@@](O1)(C)C=C)C(=O)/C=C/C(C)(C)O |
Computed by PubChem (NCBI)