Products 942627-72-7
CAS 942627-72-7 is the registry number for 8(17)13-Labdadien-15-ol - Pinus halepensis (Aleppo pine). Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(E)-2-(5-ethenyl-5-methyloxolan-2-yl)-6-hydroxy-6-methylhept-4-en-3-one (CAS 942627-72-7) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (E)-2-(5-ethenyl-5-methyloxolan-2-yl)-6-hydroxy-6-methylhept-4-en-3-one. InChIKey: WQUKMIHCFQFPQG-VQHVLOKHSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (E)-2-(5-ethenyl-5-methyloxolan-2-yl)-6-hydroxy-6-methylhept-4-en-3-one |
| InChIKey | WQUKMIHCFQFPQG-VQHVLOKHSA-N |
| SMILES | CC(C1CCC(O1)(C)C=C)C(=O)/C=C/C(C)(C)O |
Computed by PubChem (NCBI)