Products 1336986-07-2
CAS 1336986-07-2 is the registry number for 1-(6-Chlorophenyl)-7-oxabicyclo-heptane-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-(2-chloro-3,4,5,6-tetradeuteriophenyl)-7-oxabicyclo[4.1.0]heptane (CAS 1336986-07-2) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 212.71 g/mol. IUPAC name: 1-(2-chloro-3,4,5,6-tetradeuteriophenyl)-7-oxabicyclo[4.1.0]heptane. InChIKey: YXRFOZVDGYGPKQ-NMRLXUNGSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 212.71 g/mol |
| IUPAC name | 1-(2-chloro-3,4,5,6-tetradeuteriophenyl)-7-oxabicyclo[4.1.0]heptane |
| InChIKey | YXRFOZVDGYGPKQ-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C23CCCCC2O3)Cl)[2H])[2H] |
Computed by PubChem (NCBI)