CAS 1337210-27-1 is the registry number for 7-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-amine (CAS 1337210-27-1) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 7-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-amine. InChIKey: PUKVNWKWPCELQO-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 7-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-amine |
| InChIKey | PUKVNWKWPCELQO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(CC2)N)C(=C1)F |
Computed by PubChem (NCBI)