Products 133730-34-4
CAS 133730-34-4 appears in our catalog under these names: 2,4–Dimethoxyphenylboronic acid(contains varying amounts of Anhydride), 2,4-Dimethoxyphenylboronic acid/ 95+%, 2,4-Dimethoxybenzeneboronic acid, 98% , 2,4-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride), 2,4-Dimethoxyphenylboronic acid 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 500g, 10G, 1kg.
(2,4-dimethoxyphenyl)boronic acid (CAS 133730-34-4) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: (2,4-dimethoxyphenyl)boronic acid. InChIKey: SQTUYFKNCCBFRR-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)boronic acid |
| InChIKey | SQTUYFKNCCBFRR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dimethoxybenzeneboronic Acid, 2,4-Dimethoxyphenylboronic acid, (2,4-dimethoxyphenyl)boronic Acid, 2,4-dimethoxy-phenylboronic acid, 2,4-dimethoxy-phenyl-boronic acid, 2,4-Dimethoxyphenylboronic acid;2,4-Dimethoxybenzeneboronic acid, Boronic acid, B-(2,4-dimethoxyphenyl)-, Boronic acid, (2,4-dimethoxyphenyl)-, 2,4-DimethoxyphenylboronicAcid, orb2940051