CAS 1337693-39-6 is the registry number for 5-Chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1337693-39-6) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 5-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: RXPQLNKIYBMWKT-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 5-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | RXPQLNKIYBMWKT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)