CAS 1213921-24-4 appears in our catalog under these names: (S)-6-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine, 98%, (S)-6-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg.
(1S)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1213921-24-4) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: (1S)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: NKYILTKAAIUEOK-VIFPVBQESA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | (1S)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | NKYILTKAAIUEOK-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1N)C=C(C=C2F)Cl |
Computed by PubChem (NCBI)