CAS 1487958-68-8 appears in our catalog under these names: Ticagrelor Impurity 103, Ticagrelor Impurity 67. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine (CAS 1487958-68-8) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine. InChIKey: ZNRBLOZQQJVBEC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine |
| InChIKey | ZNRBLOZQQJVBEC-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)