Products 1449008-07-4
CAS 1449008-07-4 is the registry number for 2-Chloro-6-cyclopropyl-4-fluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-6-cyclopropyl-4-fluoroaniline (CAS 1449008-07-4) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 2-chloro-6-cyclopropyl-4-fluoroaniline. InChIKey: NKWOAFRELBPCPP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 2-chloro-6-cyclopropyl-4-fluoroaniline |
| InChIKey | NKWOAFRELBPCPP-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=CC(=C2)F)Cl)N |
Computed by PubChem (NCBI)