CAS 1820580-27-5 is the registry number for Ticagrelor Impurity 91. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropan-1-amine (CAS 1820580-27-5) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: trans-(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropan-1-amine. InChIKey: LVNZCEIVEMZSLV-IMTBSYHQSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropan-1-amine |
| InChIKey | LVNZCEIVEMZSLV-IMTBSYHQSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)