CAS 1337879-59-0 is the registry number for 6-Bromo-2,7-dimethyl-2H-indazole, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
6-bromo-2,7-dimethylindazole (CAS 1337879-59-0) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-2,7-dimethylindazole. InChIKey: SYGZYHGUHLCROI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-2,7-dimethylindazole |
| InChIKey | SYGZYHGUHLCROI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=CN(N=C12)C)Br |
Computed by PubChem (NCBI)