Products 1337881-39-6

CAS 1337881-39-6 is the registry number for 6-Methylisoquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-methylisoquinoline-4-carboxylic acid (CAS 1337881-39-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-methylisoquinoline-4-carboxylic acid. InChIKey: UPGZYIVLHGMJGF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO2
Molecular weight187.19 g/mol
IUPAC name6-methylisoquinoline-4-carboxylic acid
InChIKeyUPGZYIVLHGMJGF-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=NC=C2C=C1)C(=O)O

Computed by PubChem (NCBI)