CAS 133904-67-3 is the registry number for N-Boc-D-Cysteine Methyl ester, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate (CAS 133904-67-3) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate. InChIKey: NJGIAKIPSDCYAC-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate |
| InChIKey | NJGIAKIPSDCYAC-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CS)C(=O)OC |
Computed by PubChem (NCBI)