CAS 55757-46-5 appears in our catalog under these names: N-(tert-Butoxycarbonyl)-L-cysteine Methyl Ester, Methyl (tert–butoxycarbonyl)–L–cysteinate, Boc-Cys-OMe 90%, N-(TERT-BUTOXYCARBONYL)-L-CYSTEINE METH&, N-(TERT-BUTOXYCARBONYL)-L-CYSTEINE METHYL ESTER, 90%, 90%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 2,5g, 5g, 100g, 25g, 500g, 25ML, 5ML.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate (CAS 55757-46-5) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate. InChIKey: NJGIAKIPSDCYAC-LURJTMIESA-N.
| Molecular formula | C9H17NO4S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate |
| InChIKey | NJGIAKIPSDCYAC-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CS)C(=O)OC |
Computed by PubChem (NCBI)