CAS 13395-34-1 appears in our catalog under these names: (4-Methoxy-4-oxobutyl) triphenylphosphonium bromide, 95%, (4-Methoxy-4-oxobutyl)triphenylphosphonium bromide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-methoxy-4-oxobutyl)-triphenylphosphanium bromide (CAS 13395-34-1) is a chemical compound with the molecular formula C23H24BrO2P and a molecular weight of 443.3 g/mol. IUPAC name: (4-methoxy-4-oxobutyl)-triphenylphosphanium bromide. InChIKey: CMCNWTOYBHHELW-UHFFFAOYSA-M.
| Molecular formula | C23H24BrO2P |
|---|---|
| Molecular weight | 443.3 g/mol |
| IUPAC name | (4-methoxy-4-oxobutyl)-triphenylphosphanium bromide |
| InChIKey | CMCNWTOYBHHELW-UHFFFAOYSA-M |
| SMILES | COC(=O)CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)