CAS 42932-63-8 appears in our catalog under these names: (4-Carboxybutyl-d4)triphenylphosphonium Bromide, >95% (HPLC), (4-Carboxybutyl-2,2,3,3-d4)triphenylphosphonium Bromide, 98 atom % D, min 98% Chemical Purity, (4–Carboxybutyl–d4)triphenylphosphonium (bromide), (4-Carboxybutyl-d4)triphenylphosphonium (bromide). Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 250mg, 25mg, 0,1g, 0,05g, 1mg, 10mg, 5mg, 10 mg.
(4-carboxy-2,2,3,3-tetradeuteriobutyl)-triphenylphosphanium bromide (CAS 42932-63-8) is a chemical compound with the molecular formula C23H24BrO2P and a molecular weight of 447.3 g/mol. IUPAC name: (4-carboxy-2,2,3,3-tetradeuteriobutyl)-triphenylphosphanium bromide. InChIKey: MLOSJPZSZWUDSK-DEHBLRELSA-N.
| Molecular formula | C23H24BrO2P |
|---|---|
| Molecular weight | 447.3 g/mol |
| IUPAC name | (4-carboxy-2,2,3,3-tetradeuteriobutyl)-triphenylphosphanium bromide |
| InChIKey | MLOSJPZSZWUDSK-DEHBLRELSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)