CAS 42843-94-7 appears in our catalog under these names: (3–Ethoxy–3–oxopropyl)triphenylphosphonium bromide, (3-Ethoxy-3-oxopropyl)triphenylphosphonium bromide 97%, (3-Ethoxy-3-oxopropyl)triphenylphosphonium Bromide, 97%, 97%, (3-Ethoxy-3-oxopropyl)triphenylphosphonium bromide, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g.
(3-ethoxy-3-oxopropyl)-triphenylphosphanium bromide (CAS 42843-94-7) is a chemical compound with the molecular formula C23H24BrO2P and a molecular weight of 443.3 g/mol. IUPAC name: (3-ethoxy-3-oxopropyl)-triphenylphosphanium bromide. InChIKey: ANKBQEBRESYXDT-UHFFFAOYSA-M.
| Molecular formula | C23H24BrO2P |
|---|---|
| Molecular weight | 443.3 g/mol |
| IUPAC name | (3-ethoxy-3-oxopropyl)-triphenylphosphanium bromide |
| InChIKey | ANKBQEBRESYXDT-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)