CAS 86608-70-0 appears in our catalog under these names: 2-(1,3-Dioxolan-2-yl)ethyltriphenylphosphonium Bromide, 2–(1,3–Dioxolan–2–yl)ethyltriphenylphosphonium Bromide, 2-(1,3-Dioxolan-2-yl)ethyltriphenylphosphonium Bromide, >97.0%(T), 2-(1,3-Dioxolan-2-yl)ethyltriphenylphosphonium bromide 98%, (2-(1,3-Dioxolan-2-yl)ethyl)triphenylphosphonium bromide, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 500mg, 50mg, 100g, 25g, 50g, 5g, 500g.
2-(1,3-dioxolan-2-yl)ethyl-triphenylphosphanium bromide (CAS 86608-70-0) is a chemical compound with the molecular formula C23H24BrO2P and a molecular weight of 443.3 g/mol. IUPAC name: 2-(1,3-dioxolan-2-yl)ethyl-triphenylphosphanium bromide. InChIKey: ZCJKBPSRKLHANV-UHFFFAOYSA-M.
| Molecular formula | C23H24BrO2P |
|---|---|
| Molecular weight | 443.3 g/mol |
| IUPAC name | 2-(1,3-dioxolan-2-yl)ethyl-triphenylphosphanium bromide |
| InChIKey | ZCJKBPSRKLHANV-UHFFFAOYSA-M |
| SMILES | C1COC(O1)CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)