Products 133954-44-6
CAS 133954-44-6 is the registry number for Adipic acid-13C2. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(1,6-13C2)hexanedioic acid (CAS 133954-44-6) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 148.13 g/mol. IUPAC name: (1,6-13C2)hexanedioic acid. InChIKey: WNLRTRBMVRJNCN-MPOCSFTDSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 148.13 g/mol |
| IUPAC name | (1,6-13C2)hexanedioic acid |
| InChIKey | WNLRTRBMVRJNCN-MPOCSFTDSA-N |
| SMILES | C(CC[13C](=O)O)C[13C](=O)O |
Computed by PubChem (NCBI)