Products 25373-21-1
CAS 25373-21-1 appears in our catalog under these names: Hexanedioic Acid-d10, 98 atom % D, min 98% Chemical Purity, Adipic acid–d10, ADIPIC-D8 ACID-D2, 98 ATOM % D, Adipic acid-d10, 99.93%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 25mg, 5mg, 5G, 100 mg, 5 mg.
Dideuterio 2,2,3,3,4,4,5,5-octadeuteriohexanedioate (CAS 25373-21-1) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 156.20 g/mol. IUPAC name: dideuterio 2,2,3,3,4,4,5,5-octadeuteriohexanedioate. InChIKey: WNLRTRBMVRJNCN-YQMDOBQVSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 156.20 g/mol |
| IUPAC name | dideuterio 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
| InChIKey | WNLRTRBMVRJNCN-YQMDOBQVSA-N |
| SMILES | [2H]C([2H])(C(=O)O[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O[2H] |
Computed by PubChem (NCBI)