Products 52089-65-3
CAS 52089-65-3 appears in our catalog under these names: Adipic Acid-D8, >95% (HPLC), Hexanedioic-d8 Acid, 98 atom % D, min 98% Chemical Purity, ADIPIC–DB ACID, Adipic acid-d8, 99.65%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 0,5g, 0,25g, 50mg, 100 mg, 5 mg, 25 mg, 10 mg.
2,2,3,3,4,4,5,5-octadeuteriohexanedioic acid (CAS 52089-65-3) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 154.19 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriohexanedioic acid. InChIKey: WNLRTRBMVRJNCN-SVYQBANQSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 154.19 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriohexanedioic acid |
| InChIKey | WNLRTRBMVRJNCN-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)