Products 19031-55-1
CAS 19031-55-1 appears in our catalog under these names: Adipic acid-d4-1, Hexanedioic-2,2,5,5-d4 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 10 mg, 1g, 0,5g.
2,2,5,5-tetradeuteriohexanedioic acid (CAS 19031-55-1) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 150.17 g/mol. IUPAC name: 2,2,5,5-tetradeuteriohexanedioic acid. InChIKey: WNLRTRBMVRJNCN-KHORGVISSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 150.17 g/mol |
| IUPAC name | 2,2,5,5-tetradeuteriohexanedioic acid |
| InChIKey | WNLRTRBMVRJNCN-KHORGVISSA-N |
| SMILES | [2H]C([2H])(CCC([2H])([2H])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)