CAS 1339869-22-5 appears in our catalog under these names: 5-Bromo-3-ethyl-1,2,3,4-tetrahydroisoquinolin-1-one, 95%, 5-Bromo-3-ethyl-1,2,3,4-tetrahydroisoquinolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-3-ethyl-3,4-dihydro-2H-isoquinolin-1-one (CAS 1339869-22-5) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 5-bromo-3-ethyl-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: MAANYRXFXUAIRN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 5-bromo-3-ethyl-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | MAANYRXFXUAIRN-UHFFFAOYSA-N |
| SMILES | CCC1CC2=C(C=CC=C2Br)C(=O)N1 |
Computed by PubChem (NCBI)