CAS 1339891-76-7 appears in our catalog under these names: Methyl 5-chloroimidazo[1,2-c]pyrimidine-7-carboxylate, 95%, methyl 5-chloroimidazo(1,2-c)pyrimidine-7-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
Methyl 5-chloroimidazo[1,2-c]pyrimidine-7-carboxylate (CAS 1339891-76-7) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 5-chloroimidazo[1,2-c]pyrimidine-7-carboxylate. InChIKey: GANPLICYVCXNCL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 5-chloroimidazo[1,2-c]pyrimidine-7-carboxylate |
| InChIKey | GANPLICYVCXNCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NC=CN2C(=N1)Cl |
Computed by PubChem (NCBI)