CAS 1936392-58-3 is the registry number for 4-(5-Chloromethyl-[1,2,4]oxadiazol-3-yl)-pyridine 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.
5-(chloromethyl)-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole (CAS 1936392-58-3) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: 5-(chloromethyl)-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole. InChIKey: KXAMYYKRSFDXRI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole |
| InChIKey | KXAMYYKRSFDXRI-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C2=NOC(=N2)CCl)[O-] |
Computed by PubChem (NCBI)