CAS 15965-66-9 appears in our catalog under these names: 2-Chloro-1-methyl-5-nitro-1h-1,3-benzodiazole, 95%, 2-Chloro-1-methyl-5-nitro-1H-1,3-benzodiazole, 95+%, 2–Chloro–1–methyl–5–nitro–1H–benzo(d)imidazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-1-methyl-5-nitrobenzimidazole (CAS 15965-66-9) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: 2-chloro-1-methyl-5-nitrobenzimidazole. InChIKey: QNYFEUMEQHKASR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 2-chloro-1-methyl-5-nitrobenzimidazole |
| InChIKey | QNYFEUMEQHKASR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1Cl |
Computed by PubChem (NCBI)