Products 100519-66-2

CAS 100519-66-2 is the registry number for Methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 100519-66-2) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: AFQBPDNQDJCMTA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClN3O2
Molecular weight211.60 g/mol
IUPAC namemethyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate
InChIKeyAFQBPDNQDJCMTA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN2C(=C1)C(=NC=N2)Cl

Computed by PubChem (NCBI)