CAS 1340236-53-4 is the registry number for α-Cyclopropyl-4-fluoro-α,3-dimethylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-cyclopropyl-1-(4-fluoro-3-methylphenyl)ethanol (CAS 1340236-53-4) is a chemical compound with the molecular formula C12H15FO and a molecular weight of 194.24 g/mol. IUPAC name: 1-cyclopropyl-1-(4-fluoro-3-methylphenyl)ethanol. InChIKey: XKPVOPQUVGKTLS-UHFFFAOYSA-N.
| Molecular formula | C12H15FO |
|---|---|
| Molecular weight | 194.24 g/mol |
| IUPAC name | 1-cyclopropyl-1-(4-fluoro-3-methylphenyl)ethanol |
| InChIKey | XKPVOPQUVGKTLS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C2CC2)O)F |
Computed by PubChem (NCBI)