CAS 1909287-33-7 is the registry number for rac-(1R,2S)-2-(2-Fluorophenyl)cyclohexan-1-ol, trans. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Trans-(1R,2S)-2-(2-fluorophenyl)cyclohexan-1-ol (CAS 1909287-33-7) is a chemical compound with the molecular formula C12H15FO and a molecular weight of 194.24 g/mol. IUPAC name: trans-(1R,2S)-2-(2-fluorophenyl)cyclohexan-1-ol. InChIKey: OFDQYRMHMRJZQZ-CMPLNLGQSA-N.
| Molecular formula | C12H15FO |
|---|---|
| Molecular weight | 194.24 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2-fluorophenyl)cyclohexan-1-ol |
| InChIKey | OFDQYRMHMRJZQZ-CMPLNLGQSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C2=CC=CC=C2F)O |
Computed by PubChem (NCBI)