CAS 1496-36-2 appears in our catalog under these names: 1-(4-Fluorophenyl)cyclohexan-1-ol, 1-(4-Fluorophenyl)cyclohexanol, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g.
1-(4-fluorophenyl)cyclohexan-1-ol (CAS 1496-36-2) is a chemical compound with the molecular formula C12H15FO and a molecular weight of 194.24 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclohexan-1-ol. InChIKey: AQUBFIGZUKRAOL-UHFFFAOYSA-N.
| Molecular formula | C12H15FO |
|---|---|
| Molecular weight | 194.24 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclohexan-1-ol |
| InChIKey | AQUBFIGZUKRAOL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)