Products 340271-17-2
CAS 340271-17-2 appears in our catalog under these names: Cyclopentyl(4-fluorophenyl)methanol 97%, Cyclopentyl(4-fluorophenyl)methanol, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopentyl-(4-fluorophenyl)methanol (CAS 340271-17-2) is a chemical compound with the molecular formula C12H15FO and a molecular weight of 194.24 g/mol. IUPAC name: cyclopentyl-(4-fluorophenyl)methanol. InChIKey: KBULKZDPYHXKKQ-UHFFFAOYSA-N.
| Molecular formula | C12H15FO |
|---|---|
| Molecular weight | 194.24 g/mol |
| IUPAC name | cyclopentyl-(4-fluorophenyl)methanol |
| InChIKey | KBULKZDPYHXKKQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)