CAS 1340546-20-4 appears in our catalog under these names: Amisulpride Impurity 6, Amisulpride Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-ethylsulfonyl-2-methoxybenzamide (CAS 1340546-20-4) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxybenzamide. InChIKey: LCUIMXDQQZOHJR-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxybenzamide |
| InChIKey | LCUIMXDQQZOHJR-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)N)OC)N |
Computed by PubChem (NCBI)