Products 1341035-71-9

CAS 1341035-71-9 is the registry number for 5-Hydroxy-3-methoxy-naphthalene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-hydroxy-3-methoxynaphthalene-2-carboxylate (CAS 1341035-71-9) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: methyl 5-hydroxy-3-methoxynaphthalene-2-carboxylate. InChIKey: PYPSUZIVIHCEDR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O4
Molecular weight232.23 g/mol
IUPAC namemethyl 5-hydroxy-3-methoxynaphthalene-2-carboxylate
InChIKeyPYPSUZIVIHCEDR-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C=CC=C(C2=C1)O)C(=O)OC

Computed by PubChem (NCBI)